C19H29N3O3 — CID 140549374
tert-butyl 3-[2-[3-(3-ethyl-1,2-dihydrotriazol-5-yl)phenyl]ethoxy]propanoate (PubChem CID 140549374) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is tert-butyl 3-[2-[3-(3-ethyl-1,2-dihydrotriazol-5-yl)phenyl]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[3-(3-ethyl-1,2-dihydrotriazol-5-yl)phenyl]ethoxy]propanoate |
|---|---|
| PubChem CID | 140549374 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | tert-butyl 3-[2-[3-(3-ethyl-1,2-dihydrotriazol-5-yl)phenyl]ethoxy]propanoate |
| SMILES | CCN1C=C(c2cccc(CCOCCC(=O)OC(C)(C)C)c2)NN1 |
| InChI | InChI=1S/C19H29N3O3/c1-5-22-14-17(20-21-22)16-8-6-7-15(13-16)9-11-24-12-10-18(23)25-19(2,3)4/h6-8,13-14,20-21H,5,9-12H2,1-4H3 |
| InChIKey | UFUYXQVBKYFGMP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|