C29H39N3O5 — CID 145294284
5-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propanoyl-methylamino]pentanoic acid;(2-phenylphenyl)carbamic acid (PubChem CID 145294284) has the molecular formula C29H39N3O5 and a molecular weight of 509.65 g/mol. Its IUPAC name is 5-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propanoyl-methylamino]pentanoic acid;(2-phenylphenyl)carbamic acid.
| Compound Name | 5-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propanoyl-methylamino]pentanoic acid;(2-phenylphenyl)carbamic acid |
|---|---|
| PubChem CID | 145294284 |
| Molecular Formula | C29H39N3O5 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.29 |
| IUPAC Name | 5-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propanoyl-methylamino]pentanoic acid;(2-phenylphenyl)carbamic acid |
| SMILES | CN(CCCCC(=O)O)C(=O)CCN1CC2CCCC2C1.O=C(O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C16H28N2O3.C13H11NO2/c1-17(9-3-2-7-16(20)21)15(19)8-10-18-11-13-5-4-6-14(13)12-18;15-13(16)14-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h13-14H,2-12H2,1H3,(H,20,21);1-9,14H,(H,15,16) |
| InChIKey | UEEIZSGZXBBJBP-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|