C24H34ClN3O4 — CID 129054897
5-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propanoyl-methylamino]-N-(2-chloro-4-formyl-5-methoxyphenyl)pentanamide (PubChem CID 129054897) has the molecular formula C24H34ClN3O4 and a molecular weight of 464.01 g/mol. Its IUPAC name is 5-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propanoyl-methylamino]-N-(2-chloro-4-formyl-5-methoxyphenyl)pentanamide.
| Compound Name | 5-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propanoyl-methylamino]-N-(2-chloro-4-formyl-5-methoxyphenyl)pentanamide |
|---|---|
| PubChem CID | 129054897 |
| Molecular Formula | C24H34ClN3O4 |
| Molecular Weight | 464.01 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 5-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propanoyl-methylamino]-N-(2-chloro-4-formyl-5-methoxyphenyl)pentanamide |
| SMILES | COc1cc(NC(=O)CCCCN(C)C(=O)CCN2CC3CCCC3C2)c(Cl)cc1C=O |
| InChI | InChI=1S/C24H34ClN3O4/c1-27(24(31)9-11-28-14-17-6-5-7-18(17)15-28)10-4-3-8-23(30)26-21-13-22(32-2)19(16-29)12-20(21)25/h12-13,16-18H,3-11,14-15H2,1-2H3,(H,26,30) |
| InChIKey | GVBZZEKMDGKHCM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.01 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|