C17H22ClN3O5 — CID 130196623
[1-[3-(2-chloro-4-formyl-5-methoxyanilino)-3-oxopropyl]piperidin-4-yl] carbamate (PubChem CID 130196623) has the molecular formula C17H22ClN3O5 and a molecular weight of 383.83 g/mol. Its IUPAC name is [1-[3-(2-chloro-4-formyl-5-methoxyanilino)-3-oxopropyl]piperidin-4-yl] carbamate.
| Compound Name | [1-[3-(2-chloro-4-formyl-5-methoxyanilino)-3-oxopropyl]piperidin-4-yl] carbamate |
|---|---|
| PubChem CID | 130196623 |
| Molecular Formula | C17H22ClN3O5 |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | [1-[3-(2-chloro-4-formyl-5-methoxyanilino)-3-oxopropyl]piperidin-4-yl] carbamate |
| SMILES | COc1cc(NC(=O)CCN2CCC(OC(N)=O)CC2)c(Cl)cc1C=O |
| InChI | InChI=1S/C17H22ClN3O5/c1-25-15-9-14(13(18)8-11(15)10-22)20-16(23)4-7-21-5-2-12(3-6-21)26-17(19)24/h8-10,12H,2-7H2,1H3,(H2,19,24)(H,20,23) |
| InChIKey | AHFYWKWSDJYGEA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|