C25H28ClNO5 — CID 154036763
[4-[4-(2-chloro-4-formyl-5-methoxyanilino)-4-oxobutyl]phenyl] cyclohexanecarboxylate (PubChem CID 154036763) has the molecular formula C25H28ClNO5 and a molecular weight of 457.95 g/mol. Its IUPAC name is [4-[4-(2-chloro-4-formyl-5-methoxyanilino)-4-oxobutyl]phenyl] cyclohexanecarboxylate.
| Compound Name | [4-[4-(2-chloro-4-formyl-5-methoxyanilino)-4-oxobutyl]phenyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 154036763 |
| Molecular Formula | C25H28ClNO5 |
| Molecular Weight | 457.95 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | [4-[4-(2-chloro-4-formyl-5-methoxyanilino)-4-oxobutyl]phenyl] cyclohexanecarboxylate |
| SMILES | COc1cc(NC(=O)CCCc2ccc(OC(=O)C3CCCCC3)cc2)c(Cl)cc1C=O |
| InChI | InChI=1S/C25H28ClNO5/c1-31-23-15-22(21(26)14-19(23)16-28)27-24(29)9-5-6-17-10-12-20(13-11-17)32-25(30)18-7-3-2-4-8-18/h10-16,18H,2-9H2,1H3,(H,27,29) |
| InChIKey | YXWDLQAQIMZJMY-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.95 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|