C16H20ClF3N2O5 — CID 129032574
N-(2-chloro-4-formyl-5-methoxyphenyl)-5-(methylamino)pentanamide;2,2,2-trifluoroacetic acid (PubChem CID 129032574) has the molecular formula C16H20ClF3N2O5 and a molecular weight of 412.79 g/mol. Its IUPAC name is N-(2-chloro-4-formyl-5-methoxyphenyl)-5-(methylamino)pentanamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(2-chloro-4-formyl-5-methoxyphenyl)-5-(methylamino)pentanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 129032574 |
| Molecular Formula | C16H20ClF3N2O5 |
| Molecular Weight | 412.79 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | N-(2-chloro-4-formyl-5-methoxyphenyl)-5-(methylamino)pentanamide;2,2,2-trifluoroacetic acid |
| SMILES | CNCCCCC(=O)Nc1cc(OC)c(C=O)cc1Cl.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H19ClN2O3.C2HF3O2/c1-16-6-4-3-5-14(19)17-12-8-13(20-2)10(9-18)7-11(12)15;3-2(4,5)1(6)7/h7-9,16H,3-6H2,1-2H3,(H,17,19);(H,6,7) |
| InChIKey | ZHUKEOKAXOKGPL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.79 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|