C19H25ClN2O6 — CID 130269483
tert-butyl 3-[(2-chloro-4-formyl-5-methoxyphenyl)carbamoyloxymethyl]pyrrolidine-1-carboxylate (PubChem CID 130269483) has the molecular formula C19H25ClN2O6 and a molecular weight of 412.87 g/mol. Its IUPAC name is tert-butyl 3-[(2-chloro-4-formyl-5-methoxyphenyl)carbamoyloxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(2-chloro-4-formyl-5-methoxyphenyl)carbamoyloxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 130269483 |
| Molecular Formula | C19H25ClN2O6 |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | tert-butyl 3-[(2-chloro-4-formyl-5-methoxyphenyl)carbamoyloxymethyl]pyrrolidine-1-carboxylate |
| SMILES | COc1cc(NC(=O)OCC2CCN(C(=O)OC(C)(C)C)C2)c(Cl)cc1C=O |
| InChI | InChI=1S/C19H25ClN2O6/c1-19(2,3)28-18(25)22-6-5-12(9-22)11-27-17(24)21-15-8-16(26-4)13(10-23)7-14(15)20/h7-8,10,12H,5-6,9,11H2,1-4H3,(H,21,24) |
| InChIKey | IXGITEDMTGMVID-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|