C26H27ClN4O5S — CID 130196513
[1-[3-(2-chloro-4-formyl-5-methoxyanilino)-3-oxopropyl]piperidin-4-yl] N-(5-phenyl-1,3-thiazol-4-yl)carbamate (PubChem CID 130196513) has the molecular formula C26H27ClN4O5S and a molecular weight of 543.05 g/mol. Its IUPAC name is [1-[3-(2-chloro-4-formyl-5-methoxyanilino)-3-oxopropyl]piperidin-4-yl] N-(5-phenyl-1,3-thiazol-4-yl)carbamate.
| Compound Name | [1-[3-(2-chloro-4-formyl-5-methoxyanilino)-3-oxopropyl]piperidin-4-yl] N-(5-phenyl-1,3-thiazol-4-yl)carbamate |
|---|---|
| PubChem CID | 130196513 |
| Molecular Formula | C26H27ClN4O5S |
| Molecular Weight | 543.05 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | [1-[3-(2-chloro-4-formyl-5-methoxyanilino)-3-oxopropyl]piperidin-4-yl] N-(5-phenyl-1,3-thiazol-4-yl)carbamate |
| SMILES | COc1cc(NC(=O)CCN2CCC(OC(=O)Nc3ncsc3-c3ccccc3)CC2)c(Cl)cc1C=O |
| InChI | InChI=1S/C26H27ClN4O5S/c1-35-22-14-21(20(27)13-18(22)15-32)29-23(33)9-12-31-10-7-19(8-11-31)36-26(34)30-25-24(37-16-28-25)17-5-3-2-4-6-17/h2-6,13-16,19H,7-12H2,1H3,(H,29,33)(H,30,34) |
| InChIKey | NEUSYKDDJLCMIG-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.05 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|