C39H53N5O5S — CID 145343448
bis((Z)-but-2-ene);[1-[3-[[5-(4-formylanilino)-5-oxopentyl]-methylamino]-3-oxopropyl]piperidin-4-yl] N-(5-phenyl-1,3-thiazol-4-yl)carbamate (PubChem CID 145343448) has the molecular formula C39H53N5O5S and a molecular weight of 703.95 g/mol. Its IUPAC name is bis((Z)-but-2-ene);[1-[3-[[5-(4-formylanilino)-5-oxopentyl]-methylamino]-3-oxopropyl]piperidin-4-yl] N-(5-phenyl-1,3-thiazol-4-yl)carbamate.
| Compound Name | bis((Z)-but-2-ene);[1-[3-[[5-(4-formylanilino)-5-oxopentyl]-methylamino]-3-oxopropyl]piperidin-4-yl] N-(5-phenyl-1,3-thiazol-4-yl)carbamate |
|---|---|
| PubChem CID | 145343448 |
| Molecular Formula | C39H53N5O5S |
| Molecular Weight | 703.95 g/mol |
| Exact Mass | 703.38 |
| IUPAC Name | bis((Z)-but-2-ene);[1-[3-[[5-(4-formylanilino)-5-oxopentyl]-methylamino]-3-oxopropyl]piperidin-4-yl] N-(5-phenyl-1,3-thiazol-4-yl)carbamate |
| SMILES | C/C=C\C.C/C=C\C.CN(CCCCC(=O)Nc1ccc(C=O)cc1)C(=O)CCN1CCC(OC(=O)Nc2ncsc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C31H37N5O5S.2C4H8/c1-35(17-6-5-9-27(38)33-25-12-10-23(21-37)11-13-25)28(39)16-20-36-18-14-26(15-19-36)41-31(40)34-30-29(42-22-32-30)24-7-3-2-4-8-24;2*1-3-4-2/h2-4,7-8,10-13,21-22,26H,5-6,9,14-20H2,1H3,(H,33,38)(H,34,40);2*3-4H,1-2H3/b;2*4-3- |
| InChIKey | QQTGZYDUGDUNBO-KOYVTHSTSA-N |
| XLogP | 8.46 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.95 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|