C35H44N4O5 — CID 66671528
2-methyl-4-[[6-[methyl-[2-[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]ethyl]amino]-6-oxohexyl]amino]benzoic acid (PubChem CID 66671528) has the molecular formula C35H44N4O5 and a molecular weight of 600.76 g/mol. Its IUPAC name is 2-methyl-4-[[6-[methyl-[2-[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]ethyl]amino]-6-oxohexyl]amino]benzoic acid.
| Compound Name | 2-methyl-4-[[6-[methyl-[2-[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]ethyl]amino]-6-oxohexyl]amino]benzoic acid |
|---|---|
| PubChem CID | 66671528 |
| Molecular Formula | C35H44N4O5 |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.33 |
| IUPAC Name | 2-methyl-4-[[6-[methyl-[2-[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]ethyl]amino]-6-oxohexyl]amino]benzoic acid |
| SMILES | Cc1cc(NCCCCCC(=O)N(C)CCN2CCC(OC(=O)Nc3ccccc3-c3ccccc3)CC2)ccc1C(=O)O |
| InChI | InChI=1S/C35H44N4O5/c1-26-25-28(16-17-30(26)34(41)42)36-20-10-4-7-15-33(40)38(2)23-24-39-21-18-29(19-22-39)44-35(43)37-32-14-9-8-13-31(32)27-11-5-3-6-12-27/h3,5-6,8-9,11-14,16-17,25,29,36H,4,7,10,15,18-24H2,1-2H3,(H,37,43)(H,41,42) |
| InChIKey | CVBGYEWTERXTSY-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|