C38H50N6O4 — CID 66671480
[1-[2-[methyl-[6-[4-(piperazine-1-carbonyl)anilino]hexanoyl]amino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 66671480) has the molecular formula C38H50N6O4 and a molecular weight of 654.86 g/mol. Its IUPAC name is [1-[2-[methyl-[6-[4-(piperazine-1-carbonyl)anilino]hexanoyl]amino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[2-[methyl-[6-[4-(piperazine-1-carbonyl)anilino]hexanoyl]amino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 66671480 |
| Molecular Formula | C38H50N6O4 |
| Molecular Weight | 654.86 g/mol |
| Exact Mass | 654.39 |
| IUPAC Name | [1-[2-[methyl-[6-[4-(piperazine-1-carbonyl)anilino]hexanoyl]amino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | CN(CCN1CCC(OC(=O)Nc2ccccc2-c2ccccc2)CC1)C(=O)CCCCCNc1ccc(C(=O)N2CCNCC2)cc1 |
| InChI | InChI=1S/C38H50N6O4/c1-42(36(45)14-6-3-9-21-40-32-17-15-31(16-18-32)37(46)44-26-22-39-23-27-44)28-29-43-24-19-33(20-25-43)48-38(47)41-35-13-8-7-12-34(35)30-10-4-2-5-11-30/h2,4-5,7-8,10-13,15-18,33,39-40H,3,6,9,14,19-29H2,1H3,(H,41,47) |
| InChIKey | DDEKPNMQHPHNMM-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.86 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|