C39H59N5O4 — CID 72788735
[1-[2-[6-[3-(dipropylcarbamoyl)piperidin-1-yl]hexanoyl-methylamino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 72788735) has the molecular formula C39H59N5O4 and a molecular weight of 661.93 g/mol. Its IUPAC name is [1-[2-[6-[3-(dipropylcarbamoyl)piperidin-1-yl]hexanoyl-methylamino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[2-[6-[3-(dipropylcarbamoyl)piperidin-1-yl]hexanoyl-methylamino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 72788735 |
| Molecular Formula | C39H59N5O4 |
| Molecular Weight | 661.93 g/mol |
| Exact Mass | 661.46 |
| IUPAC Name | [1-[2-[6-[3-(dipropylcarbamoyl)piperidin-1-yl]hexanoyl-methylamino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | CCCN(CCC)C(=O)C1CCCN(CCCCCC(=O)N(C)CCN2CCC(OC(=O)Nc3ccccc3-c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C39H59N5O4/c1-4-23-44(24-5-2)38(46)33-17-14-26-43(31-33)25-13-7-10-20-37(45)41(3)29-30-42-27-21-34(22-28-42)48-39(47)40-36-19-12-11-18-35(36)32-15-8-6-9-16-32/h6,8-9,11-12,15-16,18-19,33-34H,4-5,7,10,13-14,17,20-31H2,1-3H3,(H,40,47) |
| InChIKey | REXBYYLTNIISKP-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.93 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|