C39H59N5O4 — CID 67005352
[1-[2-[[7-[3-(dipropylcarbamoyl)piperidin-1-yl]-2-oxoheptyl]amino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 67005352) has the molecular formula C39H59N5O4 and a molecular weight of 661.93 g/mol. Its IUPAC name is [1-[2-[[7-[3-(dipropylcarbamoyl)piperidin-1-yl]-2-oxoheptyl]amino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[2-[[7-[3-(dipropylcarbamoyl)piperidin-1-yl]-2-oxoheptyl]amino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 67005352 |
| Molecular Formula | C39H59N5O4 |
| Molecular Weight | 661.93 g/mol |
| Exact Mass | 661.46 |
| IUPAC Name | [1-[2-[[7-[3-(dipropylcarbamoyl)piperidin-1-yl]-2-oxoheptyl]amino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | CCCN(CCC)C(=O)C1CCCN(CCCCCC(=O)CNCCN2CCC(OC(=O)Nc3ccccc3-c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C39H59N5O4/c1-3-23-44(24-4-2)38(46)33-16-13-26-43(31-33)25-12-6-9-17-34(45)30-40-22-29-42-27-20-35(21-28-42)48-39(47)41-37-19-11-10-18-36(37)32-14-7-5-8-15-32/h5,7-8,10-11,14-15,18-19,33,35,40H,3-4,6,9,12-13,16-17,20-31H2,1-2H3,(H,41,47) |
| InChIKey | MMNAXFJIXLFTLJ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.93 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|