C35H51N5O4 — CID 69484339
[1-[2-[[7-[(3R)-3-(ethylcarbamoyl)piperidin-1-yl]-2-oxoheptyl]amino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 69484339) has the molecular formula C35H51N5O4 and a molecular weight of 605.82 g/mol. Its IUPAC name is [1-[2-[[7-[(3R)-3-(ethylcarbamoyl)piperidin-1-yl]-2-oxoheptyl]amino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[2-[[7-[(3R)-3-(ethylcarbamoyl)piperidin-1-yl]-2-oxoheptyl]amino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 69484339 |
| Molecular Formula | C35H51N5O4 |
| Molecular Weight | 605.82 g/mol |
| Exact Mass | 605.39 |
| IUPAC Name | [1-[2-[[7-[(3R)-3-(ethylcarbamoyl)piperidin-1-yl]-2-oxoheptyl]amino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | CCNC(=O)[C@@H]1CCCN(CCCCCC(=O)CNCCN2CCC(OC(=O)Nc3ccccc3-c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C35H51N5O4/c1-2-37-34(42)29-14-11-22-40(27-29)21-10-4-7-15-30(41)26-36-20-25-39-23-18-31(19-24-39)44-35(43)38-33-17-9-8-16-32(33)28-12-5-3-6-13-28/h3,5-6,8-9,12-13,16-17,29,31,36H,2,4,7,10-11,14-15,18-27H2,1H3,(H,37,42)(H,38,43)/t29-/m1/s1 |
| InChIKey | OSZXJFOTSYXQJM-GDLZYMKVSA-N |
| XLogP | 4.93 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.82 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|