C32H38N4O3 — CID 66756087
[1-[2-[[2-[4-(cyclopropylamino)-2-methylphenyl]-2-oxoethyl]amino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 66756087) has the molecular formula C32H38N4O3 and a molecular weight of 526.68 g/mol. Its IUPAC name is [1-[2-[[2-[4-(cyclopropylamino)-2-methylphenyl]-2-oxoethyl]amino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[2-[[2-[4-(cyclopropylamino)-2-methylphenyl]-2-oxoethyl]amino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 66756087 |
| Molecular Formula | C32H38N4O3 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | [1-[2-[[2-[4-(cyclopropylamino)-2-methylphenyl]-2-oxoethyl]amino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | Cc1cc(NC2CC2)ccc1C(=O)CNCCN1CCC(OC(=O)Nc2ccccc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C32H38N4O3/c1-23-21-26(34-25-11-12-25)13-14-28(23)31(37)22-33-17-20-36-18-15-27(16-19-36)39-32(38)35-30-10-6-5-9-29(30)24-7-3-2-4-8-24/h2-10,13-14,21,25,27,33-34H,11-12,15-20,22H2,1H3,(H,35,38) |
| InChIKey | ZXTSFPPJBYDWJQ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|