C34H41N5O5 — CID 174814611
[1-[3-[[5-(4-formylanilino)-5-oxopentyl]-methylamino]-3-oxopropyl]piperidin-4-yl] N-(2-phenylanilino)carbamate (PubChem CID 174814611) has the molecular formula C34H41N5O5 and a molecular weight of 599.73 g/mol. Its IUPAC name is [1-[3-[[5-(4-formylanilino)-5-oxopentyl]-methylamino]-3-oxopropyl]piperidin-4-yl] N-(2-phenylanilino)carbamate.
| Compound Name | [1-[3-[[5-(4-formylanilino)-5-oxopentyl]-methylamino]-3-oxopropyl]piperidin-4-yl] N-(2-phenylanilino)carbamate |
|---|---|
| PubChem CID | 174814611 |
| Molecular Formula | C34H41N5O5 |
| Molecular Weight | 599.73 g/mol |
| Exact Mass | 599.31 |
| IUPAC Name | [1-[3-[[5-(4-formylanilino)-5-oxopentyl]-methylamino]-3-oxopropyl]piperidin-4-yl] N-(2-phenylanilino)carbamate |
| SMILES | CN(CCCCC(=O)Nc1ccc(C=O)cc1)C(=O)CCN1CCC(OC(=O)NNc2ccccc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C34H41N5O5/c1-38(21-8-7-13-32(41)35-28-16-14-26(25-40)15-17-28)33(42)20-24-39-22-18-29(19-23-39)44-34(43)37-36-31-12-6-5-11-30(31)27-9-3-2-4-10-27/h2-6,9-12,14-17,25,29,36H,7-8,13,18-24H2,1H3,(H,35,41)(H,37,43) |
| InChIKey | SEUHNJGJICSKHR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.73 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|