C18H26BrClN2O4 — CID 129032587
tert-butyl N-[5-(4-bromo-2-chloro-5-methoxyanilino)-5-oxopentyl]-N-methylcarbamate (PubChem CID 129032587) has the molecular formula C18H26BrClN2O4 and a molecular weight of 449.77 g/mol. Its IUPAC name is tert-butyl N-[5-(4-bromo-2-chloro-5-methoxyanilino)-5-oxopentyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[5-(4-bromo-2-chloro-5-methoxyanilino)-5-oxopentyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 129032587 |
| Molecular Formula | C18H26BrClN2O4 |
| Molecular Weight | 449.77 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | tert-butyl N-[5-(4-bromo-2-chloro-5-methoxyanilino)-5-oxopentyl]-N-methylcarbamate |
| SMILES | COc1cc(NC(=O)CCCCN(C)C(=O)OC(C)(C)C)c(Cl)cc1Br |
| InChI | InChI=1S/C18H26BrClN2O4/c1-18(2,3)26-17(24)22(4)9-7-6-8-16(23)21-14-11-15(25-5)12(19)10-13(14)20/h10-11H,6-9H2,1-5H3,(H,21,23) |
| InChIKey | GEIBTAIWZHFMRE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.77 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|