C15H20BrClN2O4 — CID 86891822
methyl N-[4-(3-bromo-5-chloro-2-ethoxyanilino)-4-oxobutyl]-N-methylcarbamate (PubChem CID 86891822) has the molecular formula C15H20BrClN2O4 and a molecular weight of 407.69 g/mol. Its IUPAC name is methyl N-[4-(3-bromo-5-chloro-2-ethoxyanilino)-4-oxobutyl]-N-methylcarbamate.
| Compound Name | methyl N-[4-(3-bromo-5-chloro-2-ethoxyanilino)-4-oxobutyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 86891822 |
| Molecular Formula | C15H20BrClN2O4 |
| Molecular Weight | 407.69 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | methyl N-[4-(3-bromo-5-chloro-2-ethoxyanilino)-4-oxobutyl]-N-methylcarbamate |
| SMILES | CCOc1c(Br)cc(Cl)cc1NC(=O)CCCN(C)C(=O)OC |
| InChI | InChI=1S/C15H20BrClN2O4/c1-4-23-14-11(16)8-10(17)9-12(14)18-13(20)6-5-7-19(2)15(21)22-3/h8-9H,4-7H2,1-3H3,(H,18,20) |
| InChIKey | OXRCTGJTYQKHOS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.69 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |