C16H18BrClN2O3 — CID 86869851
3-(3-bromo-5-chloro-2-ethoxyphenyl)-1-[1-(furan-2-yl)ethyl]-1-methylurea (PubChem CID 86869851) has the molecular formula C16H18BrClN2O3 and a molecular weight of 401.69 g/mol. Its IUPAC name is 3-(3-bromo-5-chloro-2-ethoxyphenyl)-1-[1-(furan-2-yl)ethyl]-1-methylurea.
| Compound Name | 3-(3-bromo-5-chloro-2-ethoxyphenyl)-1-[1-(furan-2-yl)ethyl]-1-methylurea |
|---|---|
| PubChem CID | 86869851 |
| Molecular Formula | C16H18BrClN2O3 |
| Molecular Weight | 401.69 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | 3-(3-bromo-5-chloro-2-ethoxyphenyl)-1-[1-(furan-2-yl)ethyl]-1-methylurea |
| SMILES | CCOc1c(Br)cc(Cl)cc1NC(=O)N(C)C(C)c1ccco1 |
| InChI | InChI=1S/C16H18BrClN2O3/c1-4-22-15-12(17)8-11(18)9-13(15)19-16(21)20(3)10(2)14-6-5-7-23-14/h5-10H,4H2,1-3H3,(H,19,21) |
| InChIKey | ISCUBBMMDMYQGT-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.69 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |