C22H33Cl2NO4 — CID 156723244
tert-butyl N-[5-(4,5-dichloro-2-prop-2-enoxyphenyl)-5-oxopentyl]-N-methylcarbamate;ethane (PubChem CID 156723244) has the molecular formula C22H33Cl2NO4 and a molecular weight of 446.42 g/mol. Its IUPAC name is tert-butyl N-[5-(4,5-dichloro-2-prop-2-enoxyphenyl)-5-oxopentyl]-N-methylcarbamate;ethane.
| Compound Name | tert-butyl N-[5-(4,5-dichloro-2-prop-2-enoxyphenyl)-5-oxopentyl]-N-methylcarbamate;ethane |
|---|---|
| PubChem CID | 156723244 |
| Molecular Formula | C22H33Cl2NO4 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | tert-butyl N-[5-(4,5-dichloro-2-prop-2-enoxyphenyl)-5-oxopentyl]-N-methylcarbamate;ethane |
| SMILES | C=CCOc1cc(Cl)c(Cl)cc1C(=O)CCCCN(C)C(=O)OC(C)(C)C.CC |
| InChI | InChI=1S/C20H27Cl2NO4.C2H6/c1-6-11-26-18-13-16(22)15(21)12-14(18)17(24)9-7-8-10-23(5)19(25)27-20(2,3)4;1-2/h6,12-13H,1,7-11H2,2-5H3;1-2H3 |
| InChIKey | DAIKSHQXKXEOLT-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|