C22H32Cl2N2O3S — CID 156723123
tert-butyl 3-[(tert-butylsulfanylamino)-(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]azetidine-1-carboxylate (PubChem CID 156723123) has the molecular formula C22H32Cl2N2O3S and a molecular weight of 475.48 g/mol. Its IUPAC name is tert-butyl 3-[(tert-butylsulfanylamino)-(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(tert-butylsulfanylamino)-(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 156723123 |
| Molecular Formula | C22H32Cl2N2O3S |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | tert-butyl 3-[(tert-butylsulfanylamino)-(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]azetidine-1-carboxylate |
| SMILES | C=CCOc1cc(Cl)c(Cl)cc1C(NSC(C)(C)C)C1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C22H32Cl2N2O3S/c1-8-9-28-18-11-17(24)16(23)10-15(18)19(25-30-22(5,6)7)14-12-26(13-14)20(27)29-21(2,3)4/h8,10-11,14,19,25H,1,9,12-13H2,2-7H3 |
| InChIKey | XRGFGZBRRBZYMN-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|