C15H18ClNO — CID 11065293
N-benzyl-2-chloro-N-cyclohex-2-en-1-ylacetamide (PubChem CID 11065293) has the molecular formula C15H18ClNO and a molecular weight of 263.77 g/mol. Its IUPAC name is N-benzyl-2-chloro-N-cyclohex-2-en-1-ylacetamide.
| Compound Name | N-benzyl-2-chloro-N-cyclohex-2-en-1-ylacetamide |
|---|---|
| PubChem CID | 11065293 |
| Molecular Formula | C15H18ClNO |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | N-benzyl-2-chloro-N-cyclohex-2-en-1-ylacetamide |
| SMILES | O=C(CCl)N(Cc1ccccc1)C1C=CCCC1 |
| InChI | InChI=1S/C15H18ClNO/c16-11-15(18)17(14-9-5-2-6-10-14)12-13-7-3-1-4-8-13/h1,3-5,7-9,14H,2,6,10-12H2 |
| InChIKey | VJLDZTRGPIYYBA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|