C21H25N — CID 139091236
(1R)-N,N-dibenzylcyclohept-2-en-1-amine (PubChem CID 139091236) has the molecular formula C21H25N and a molecular weight of 291.44 g/mol. Its IUPAC name is (1R)-N,N-dibenzylcyclohept-2-en-1-amine.
| Compound Name | (1R)-N,N-dibenzylcyclohept-2-en-1-amine |
|---|---|
| PubChem CID | 139091236 |
| Molecular Formula | C21H25N |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | (1R)-N,N-dibenzylcyclohept-2-en-1-amine |
| SMILES | C1=C[C@H](N(Cc2ccccc2)Cc2ccccc2)CCCC1 |
| InChI | InChI=1S/C21H25N/c1-2-10-16-21(15-9-1)22(17-19-11-5-3-6-12-19)18-20-13-7-4-8-14-20/h3-9,11-15,21H,1-2,10,16-18H2/t21-/m0/s1 |
| InChIKey | IOQHHGRGWAVGEP-NRFANRHFSA-N |
| XLogP | 5.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|