C20H24N2 — CID 101487462
N'-benzyl-N'-cyclopent-2-en-1-yl-N-phenylethane-1,2-diamine (PubChem CID 101487462) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is N'-benzyl-N'-cyclopent-2-en-1-yl-N-phenylethane-1,2-diamine.
| Compound Name | N'-benzyl-N'-cyclopent-2-en-1-yl-N-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 101487462 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | N'-benzyl-N'-cyclopent-2-en-1-yl-N-phenylethane-1,2-diamine |
| SMILES | C1=CC(N(CCNc2ccccc2)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H24N2/c1-3-9-18(10-4-1)17-22(20-13-7-8-14-20)16-15-21-19-11-5-2-6-12-19/h1-7,9-13,20-21H,8,14-17H2 |
| InChIKey | IBIVTAYPLZZFAV-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|