C17H18LiN — CID 134888964
lithium N,N-dibenzylcyclopropanamine (PubChem CID 134888964) has the molecular formula C17H18LiN and a molecular weight of 243.28 g/mol. Its IUPAC name is lithium N,N-dibenzylcyclopropanamine.
| Compound Name | lithium N,N-dibenzylcyclopropanamine |
|---|---|
| PubChem CID | 134888964 |
| Molecular Formula | C17H18LiN |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | lithium N,N-dibenzylcyclopropanamine |
| SMILES | [Li+].c1ccc(CN(Cc2ccccc2)[C@@H]2[CH-]C2)cc1 |
| InChI | InChI=1S/C17H18N.Li/c1-3-7-15(8-4-1)13-18(17-11-12-17)14-16-9-5-2-6-10-16;/h1-11,17H,12-14H2;/q-1;+1/t17-;/m1./s1 |
| InChIKey | AEISXNVXMYTQDR-UNTBIKODSA-N |
| XLogP | 0.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|