C19H22N2 — CID 10912863
(1R,5S)-N,N-dibenzyl-3-azabicyclo[3.1.0]hexan-6-amine (PubChem CID 10912863) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is (1R,5S)-N,N-dibenzyl-3-azabicyclo[3.1.0]hexan-6-amine.
| Compound Name | (1R,5S)-N,N-dibenzyl-3-azabicyclo[3.1.0]hexan-6-amine |
|---|---|
| PubChem CID | 10912863 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | (1R,5S)-N,N-dibenzyl-3-azabicyclo[3.1.0]hexan-6-amine |
| SMILES | c1ccc(CN(Cc2ccccc2)C2[C@H]3CNC[C@@H]23)cc1 |
| InChI | InChI=1S/C19H22N2/c1-3-7-15(8-4-1)13-21(14-16-9-5-2-6-10-16)19-17-11-20-12-18(17)19/h1-10,17-20H,11-14H2/t17-,18+,19? |
| InChIKey | KDGSINLHKLATBU-DFNIBXOVSA-N |
| XLogP | 2.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |