C14H22N2 — CID 164648058
N-benzyl-N,5-dimethylpiperidin-3-amine (PubChem CID 164648058) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is N-benzyl-N,5-dimethylpiperidin-3-amine.
| Compound Name | N-benzyl-N,5-dimethylpiperidin-3-amine |
|---|---|
| PubChem CID | 164648058 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | N-benzyl-N,5-dimethylpiperidin-3-amine |
| SMILES | CC1CNCC(N(C)Cc2ccccc2)C1 |
| InChI | InChI=1S/C14H22N2/c1-12-8-14(10-15-9-12)16(2)11-13-6-4-3-5-7-13/h3-7,12,14-15H,8-11H2,1-2H3 |
| InChIKey | JLZZTIWHHRYUPG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |