C25H23F3N2 — CID 91431585
(5R)-N,N-dibenzyl-3-(2,3,4-trifluorophenyl)-3-azabicyclo[3.1.0]hexan-6-amine (PubChem CID 91431585) has the molecular formula C25H23F3N2 and a molecular weight of 408.47 g/mol. Its IUPAC name is (5R)-N,N-dibenzyl-3-(2,3,4-trifluorophenyl)-3-azabicyclo[3.1.0]hexan-6-amine.
| Compound Name | (5R)-N,N-dibenzyl-3-(2,3,4-trifluorophenyl)-3-azabicyclo[3.1.0]hexan-6-amine |
|---|---|
| PubChem CID | 91431585 |
| Molecular Formula | C25H23F3N2 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | (5R)-N,N-dibenzyl-3-(2,3,4-trifluorophenyl)-3-azabicyclo[3.1.0]hexan-6-amine |
| SMILES | Fc1ccc(N2CC3C(N(Cc4ccccc4)Cc4ccccc4)[C@H]3C2)c(F)c1F |
| InChI | InChI=1S/C25H23F3N2/c26-21-11-12-22(24(28)23(21)27)29-15-19-20(16-29)25(19)30(13-17-7-3-1-4-8-17)14-18-9-5-2-6-10-18/h1-12,19-20,25H,13-16H2/t19-,20?,25?/m0/s1 |
| InChIKey | HXPHXYPVVGEFLN-IXCHTMLJSA-N |
| XLogP | 5.24 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|