C18H18F3N3O — CID 113106639
N-benzyl-4-(2,3,4-trifluorophenyl)piperazine-1-carboxamide (PubChem CID 113106639) has the molecular formula C18H18F3N3O and a molecular weight of 349.36 g/mol. Its IUPAC name is N-benzyl-4-(2,3,4-trifluorophenyl)piperazine-1-carboxamide.
| Compound Name | N-benzyl-4-(2,3,4-trifluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113106639 |
| Molecular Formula | C18H18F3N3O |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | N-benzyl-4-(2,3,4-trifluorophenyl)piperazine-1-carboxamide |
| SMILES | O=C(NCc1ccccc1)N1CCN(c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C18H18F3N3O/c19-14-6-7-15(17(21)16(14)20)23-8-10-24(11-9-23)18(25)22-12-13-4-2-1-3-5-13/h1-7H,8-12H2,(H,22,25) |
| InChIKey | ZSKHMMUMGOMOAS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|