C18H22N2 — CID 10563715
4-[benzyl(cyclohex-2-en-1-yl)amino]-2-methylidenebutanenitrile (PubChem CID 10563715) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 4-[benzyl(cyclohex-2-en-1-yl)amino]-2-methylidenebutanenitrile.
| Compound Name | 4-[benzyl(cyclohex-2-en-1-yl)amino]-2-methylidenebutanenitrile |
|---|---|
| PubChem CID | 10563715 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 4-[benzyl(cyclohex-2-en-1-yl)amino]-2-methylidenebutanenitrile |
| SMILES | C=C(C#N)CCN(Cc1ccccc1)C1C=CCCC1 |
| InChI | InChI=1S/C18H22N2/c1-16(14-19)12-13-20(18-10-6-3-7-11-18)15-17-8-4-2-5-9-17/h2,4-6,8-10,18H,1,3,7,11-13,15H2 |
| InChIKey | OSFQVSIDOVFRPT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|