C19H19BrN2O — CID 15590276
1-[(4-bromophenyl)methyl]-1-cyclopent-2-en-1-yl-3-phenylurea (PubChem CID 15590276) has the molecular formula C19H19BrN2O and a molecular weight of 371.28 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-1-cyclopent-2-en-1-yl-3-phenylurea.
| Compound Name | 1-[(4-bromophenyl)methyl]-1-cyclopent-2-en-1-yl-3-phenylurea |
|---|---|
| PubChem CID | 15590276 |
| Molecular Formula | C19H19BrN2O |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-1-cyclopent-2-en-1-yl-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)N(Cc1ccc(Br)cc1)C1C=CCC1 |
| InChI | InChI=1S/C19H19BrN2O/c20-16-12-10-15(11-13-16)14-22(18-8-4-5-9-18)19(23)21-17-6-2-1-3-7-17/h1-4,6-8,10-13,18H,5,9,14H2,(H,21,23) |
| InChIKey | VBXCLBZJVWKVJT-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|