C12H16N2O5S — CID 95916046
N'-[(3R,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]-4-methoxybenzohydrazide (PubChem CID 95916046) has the molecular formula C12H16N2O5S and a molecular weight of 300.34 g/mol. Its IUPAC name is N'-[(3R,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]-4-methoxybenzohydrazide.
| Compound Name | N'-[(3R,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]-4-methoxybenzohydrazide |
|---|---|
| PubChem CID | 95916046 |
| Molecular Formula | C12H16N2O5S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | N'-[(3R,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]-4-methoxybenzohydrazide |
| SMILES | COc1ccc(C(=O)NN[C@H]2CS(=O)(=O)C[C@H]2O)cc1 |
| InChI | InChI=1S/C12H16N2O5S/c1-19-9-4-2-8(3-5-9)12(16)14-13-10-6-20(17,18)7-11(10)15/h2-5,10-11,13,15H,6-7H2,1H3,(H,14,16)/t10-,11+/m0/s1 |
| InChIKey | CMZAXTFKZWPKRK-WDEREUQCSA-N |
| XLogP | -0.91 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|