C12H15NO4 — CID 146504792
N-[(3S)-2-hydroxyoxolan-3-yl]-4-methoxybenzamide (PubChem CID 146504792) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is N-[(3S)-2-hydroxyoxolan-3-yl]-4-methoxybenzamide.
| Compound Name | N-[(3S)-2-hydroxyoxolan-3-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 146504792 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | N-[(3S)-2-hydroxyoxolan-3-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N[C@H]2CCOC2O)cc1 |
| InChI | InChI=1S/C12H15NO4/c1-16-9-4-2-8(3-5-9)11(14)13-10-6-7-17-12(10)15/h2-5,10,12,15H,6-7H2,1H3,(H,13,14)/t10-,12?/m0/s1 |
| InChIKey | YKNCHABVYSZIEA-NUHJPDEHSA-N |
| XLogP | 0.53 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |