C18H22N2O3S — CID 7124812
(3S,4R)-4-N-benzyl-3-N-(4-methoxyphenyl)-1,1-dioxothiolane-3,4-diamine (PubChem CID 7124812) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is (3S,4R)-4-N-benzyl-3-N-(4-methoxyphenyl)-1,1-dioxothiolane-3,4-diamine.
| Compound Name | (3S,4R)-4-N-benzyl-3-N-(4-methoxyphenyl)-1,1-dioxothiolane-3,4-diamine |
|---|---|
| PubChem CID | 7124812 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | (3S,4R)-4-N-benzyl-3-N-(4-methoxyphenyl)-1,1-dioxothiolane-3,4-diamine |
| SMILES | COc1ccc(N[C@@H]2CS(=O)(=O)C[C@@H]2NCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H22N2O3S/c1-23-16-9-7-15(8-10-16)20-18-13-24(21,22)12-17(18)19-11-14-5-3-2-4-6-14/h2-10,17-20H,11-13H2,1H3/t17-,18+/m0/s1 |
| InChIKey | IVBBPUCRCSFDLZ-ZWKOTPCHSA-N |
| XLogP | 2.06 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|