C7H11Cl3O3S — CID 40549384
(3S,4S)-3-chloro-4-[(2S)-2,3-dichloropropoxy]thiolane 1,1-dioxide (PubChem CID 40549384) has the molecular formula C7H11Cl3O3S and a molecular weight of 281.59 g/mol. Its IUPAC name is (3S,4S)-3-chloro-4-[(2S)-2,3-dichloropropoxy]thiolane 1,1-dioxide.
| Compound Name | (3S,4S)-3-chloro-4-[(2S)-2,3-dichloropropoxy]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 40549384 |
| Molecular Formula | C7H11Cl3O3S |
| Molecular Weight | 281.59 g/mol |
| Exact Mass | 279.95 |
| IUPAC Name | (3S,4S)-3-chloro-4-[(2S)-2,3-dichloropropoxy]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)C[C@@H](Cl)[C@@H](OC[C@H](Cl)CCl)C1 |
| InChI | InChI=1S/C7H11Cl3O3S/c8-1-5(9)2-13-7-4-14(11,12)3-6(7)10/h5-7H,1-4H2/t5-,6-,7+/m1/s1 |
| InChIKey | OTBFJKBRVDCGDS-QYNIQEEDSA-N |
| XLogP | 1.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.59 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|