C6H9F2IO3S — CID 114774770
3-(2,2-difluoroethoxy)-4-iodothiolane 1,1-dioxide (PubChem CID 114774770) has the molecular formula C6H9F2IO3S and a molecular weight of 326.10 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-4-iodothiolane 1,1-dioxide.
| Compound Name | 3-(2,2-difluoroethoxy)-4-iodothiolane 1,1-dioxide |
|---|---|
| PubChem CID | 114774770 |
| Molecular Formula | C6H9F2IO3S |
| Molecular Weight | 326.10 g/mol |
| Exact Mass | 325.93 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-4-iodothiolane 1,1-dioxide |
| SMILES | O=S1(=O)CC(I)C(OCC(F)F)C1 |
| InChI | InChI=1S/C6H9F2IO3S/c7-6(8)1-12-5-3-13(10,11)2-4(5)9/h4-6H,1-3H2 |
| InChIKey | BQZYIQWBFWDYAI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.10 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|