C6H9F3O3S — CID 130693991
3-(2,2,2-trifluoroethylsulfonyl)oxolane (PubChem CID 130693991) has the molecular formula C6H9F3O3S and a molecular weight of 218.20 g/mol. Its IUPAC name is 3-(2,2,2-trifluoroethylsulfonyl)oxolane.
| Compound Name | 3-(2,2,2-trifluoroethylsulfonyl)oxolane |
|---|---|
| PubChem CID | 130693991 |
| Molecular Formula | C6H9F3O3S |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.02 |
| IUPAC Name | 3-(2,2,2-trifluoroethylsulfonyl)oxolane |
| SMILES | O=S(=O)(CC(F)(F)F)C1CCOC1 |
| InChI | InChI=1S/C6H9F3O3S/c7-6(8,9)4-13(10,11)5-1-2-12-3-5/h5H,1-4H2 |
| InChIKey | GRMSODNSPLOQND-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |