C9H15Cl2NO4S — CID 94854113
[(2S)-2,3-dichloropropyl] N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamate (PubChem CID 94854113) has the molecular formula C9H15Cl2NO4S and a molecular weight of 304.20 g/mol. Its IUPAC name is [(2S)-2,3-dichloropropyl] N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamate.
| Compound Name | [(2S)-2,3-dichloropropyl] N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamate |
|---|---|
| PubChem CID | 94854113 |
| Molecular Formula | C9H15Cl2NO4S |
| Molecular Weight | 304.20 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | [(2S)-2,3-dichloropropyl] N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamate |
| SMILES | C[C@]1(NC(=O)OC[C@H](Cl)CCl)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H15Cl2NO4S/c1-9(2-3-17(14,15)6-9)12-8(13)16-5-7(11)4-10/h7H,2-6H2,1H3,(H,12,13)/t7-,9+/m1/s1 |
| InChIKey | ZAPHEALQIYEHME-APPZFPTMSA-N |
| XLogP | 1.14 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|