About [(2S)-2,3-dichloropropyl] N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamate
[(2S)-2,3-dichloropropyl] N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamate (PubChem CID 94854113) has the molecular formula C9H15Cl2NO4S
and a molecular weight of 304.20 g/mol. Its IUPAC name is [(2S)-2,3-dichloropropyl] N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamate.
Molecular Properties
| Compound Name | [(2S)-2,3-dichloropropyl] N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamate |
| PubChem CID | 94854113 |
| Molecular Formula | C9H15Cl2NO4S |
| Molecular Weight | 304.20 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | [(2S)-2,3-dichloropropyl] N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamate |
| SMILES | C[C@]1(NC(=O)OC[C@H](Cl)CCl)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H15Cl2NO4S/c1-9(2-3-17(14,15)6-9)12-8(13)16-5-7(11)4-10/h7H,2-6H2,1H3,(H,12,13)/t7-,9+/m1/s1 |
| InChIKey | ZAPHEALQIYEHME-APPZFPTMSA-N |
| XLogP | 1.14 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-2,3-dichloropropyl] N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2,3-dichloropropyl] N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamate?
The IUPAC name of [(2S)-2,3-dichloropropyl] N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamate (CID 94854113) is [(2S)-2,3-dichloropropyl] N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamate.
What is the SMILES notation for [(2S)-2,3-dichloropropyl] N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamate?
The canonical SMILES for [(2S)-2,3-dichloropropyl] N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamate is C[C@]1(NC(=O)OC[C@H](Cl)CCl)CCS(=O)(=O)C1.
What is the InChIKey of [(2S)-2,3-dichloropropyl] N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamate?
The InChIKey is ZAPHEALQIYEHME-APPZFPTMSA-N. The full InChI is InChI=1S/C9H15Cl2NO4S/c1-9(2-3-17(14,15)6-9)12-8(13)16-5-7(11)4-10/h7H,2-6H2,1H3,(H,12,13)/t7-,9+/m1/s1.
What are the key properties of [(2S)-2,3-dichloropropyl] N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamate?
[(2S)-2,3-dichloropropyl] N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamate has a molecular weight of 304.20 g/mol, XLogP of 1.14, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2,3-dichloropropyl] N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamate is sourced from PubChem (CID 94854113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).