C8H13Br2NO4S — CID 94854091
2,2-dibromoethyl N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamate (PubChem CID 94854091) has the molecular formula C8H13Br2NO4S and a molecular weight of 379.07 g/mol. Its IUPAC name is 2,2-dibromoethyl N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamate.
| Compound Name | 2,2-dibromoethyl N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamate |
|---|---|
| PubChem CID | 94854091 |
| Molecular Formula | C8H13Br2NO4S |
| Molecular Weight | 379.07 g/mol |
| Exact Mass | 376.89 |
| IUPAC Name | 2,2-dibromoethyl N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamate |
| SMILES | C[C@]1(NC(=O)OCC(Br)Br)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H13Br2NO4S/c1-8(2-3-16(13,14)5-8)11-7(12)15-4-6(9)10/h6H,2-5H2,1H3,(H,11,12)/t8-/m0/s1 |
| InChIKey | CVYKNEHMNKOOCX-QMMMGPOBSA-N |
| XLogP | 1.41 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.07 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|