C8H13Br2NO3S2 — CID 94854100
O-(2,2-dibromoethyl) N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]carbamothioate (PubChem CID 94854100) has the molecular formula C8H13Br2NO3S2 and a molecular weight of 395.14 g/mol. Its IUPAC name is O-(2,2-dibromoethyl) N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]carbamothioate.
| Compound Name | O-(2,2-dibromoethyl) N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]carbamothioate |
|---|---|
| PubChem CID | 94854100 |
| Molecular Formula | C8H13Br2NO3S2 |
| Molecular Weight | 395.14 g/mol |
| Exact Mass | 392.87 |
| IUPAC Name | O-(2,2-dibromoethyl) N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]carbamothioate |
| SMILES | C[C@@]1(NC(=S)OCC(Br)Br)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H13Br2NO3S2/c1-8(2-3-16(12,13)5-8)11-7(15)14-4-6(9)10/h6H,2-5H2,1H3,(H,11,15)/t8-/m1/s1 |
| InChIKey | WEALIYCQKVZTSY-MRVPVSSYSA-N |
| XLogP | 1.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.14 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|