C7H10Br2ClNO3S2 — CID 94854103
O-(2,2-dibromoethyl) N-[(3S,4R)-4-chloro-1,1-dioxothiolan-3-yl]carbamothioate (PubChem CID 94854103) has the molecular formula C7H10Br2ClNO3S2 and a molecular weight of 415.56 g/mol. Its IUPAC name is O-(2,2-dibromoethyl) N-[(3S,4R)-4-chloro-1,1-dioxothiolan-3-yl]carbamothioate.
| Compound Name | O-(2,2-dibromoethyl) N-[(3S,4R)-4-chloro-1,1-dioxothiolan-3-yl]carbamothioate |
|---|---|
| PubChem CID | 94854103 |
| Molecular Formula | C7H10Br2ClNO3S2 |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 412.82 |
| IUPAC Name | O-(2,2-dibromoethyl) N-[(3S,4R)-4-chloro-1,1-dioxothiolan-3-yl]carbamothioate |
| SMILES | O=S1(=O)C[C@H](NC(=S)OCC(Br)Br)[C@@H](Cl)C1 |
| InChI | InChI=1S/C7H10Br2ClNO3S2/c8-6(9)1-14-7(15)11-5-3-16(12,13)2-4(5)10/h4-6H,1-3H2,(H,11,15)/t4-,5-/m0/s1 |
| InChIKey | MBCWQHPYULWERD-WHFBIAKZSA-N |
| XLogP | 1.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|