C11H20ClNO6S2 — CID 99977553
O-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl] N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]carbamothioate (PubChem CID 99977553) has the molecular formula C11H20ClNO6S2 and a molecular weight of 361.87 g/mol. Its IUPAC name is O-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl] N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]carbamothioate.
| Compound Name | O-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl] N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]carbamothioate |
|---|---|
| PubChem CID | 99977553 |
| Molecular Formula | C11H20ClNO6S2 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | O-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl] N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]carbamothioate |
| SMILES | O=S1(=O)C[C@@H](Cl)[C@@H](NC(=S)OCCOCCOCCO)C1 |
| InChI | InChI=1S/C11H20ClNO6S2/c12-9-7-21(15,16)8-10(9)13-11(20)19-6-5-18-4-3-17-2-1-14/h9-10,14H,1-8H2,(H,13,20)/t9-,10+/m1/s1 |
| InChIKey | SLLJUNKVHKSJQD-ZJUUUORDSA-N |
| XLogP | -0.69 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|