C11H19NO7S — CID 99977562
2-[2-(2-hydroxyethoxy)ethoxy]ethyl N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]carbamate (PubChem CID 99977562) has the molecular formula C11H19NO7S and a molecular weight of 309.34 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethoxy]ethyl N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]carbamate.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethyl N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]carbamate |
|---|---|
| PubChem CID | 99977562 |
| Molecular Formula | C11H19NO7S |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethyl N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]carbamate |
| SMILES | O=C(N[C@@H]1C=CS(=O)(=O)C1)OCCOCCOCCO |
| InChI | InChI=1S/C11H19NO7S/c13-2-3-17-4-5-18-6-7-19-11(14)12-10-1-8-20(15,16)9-10/h1,8,10,13H,2-7,9H2,(H,12,14)/t10-/m1/s1 |
| InChIKey | UWEOFVLGINDIHW-SNVBAGLBSA-N |
| XLogP | -0.95 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|