C12H22O10 — CID 175191375
bis[2-(2-hydroxyethoxy)ethyl] 2,3-dihydroxybutanedioate (PubChem CID 175191375) has the molecular formula C12H22O10 and a molecular weight of 326.30 g/mol. Its IUPAC name is bis[2-(2-hydroxyethoxy)ethyl] 2,3-dihydroxybutanedioate.
| Compound Name | bis[2-(2-hydroxyethoxy)ethyl] 2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 175191375 |
| Molecular Formula | C12H22O10 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | bis[2-(2-hydroxyethoxy)ethyl] 2,3-dihydroxybutanedioate |
| SMILES | O=C(OCCOCCO)C(O)C(O)C(=O)OCCOCCO |
| InChI | InChI=1S/C12H22O10/c13-1-3-19-5-7-21-11(17)9(15)10(16)12(18)22-8-6-20-4-2-14/h9-10,13-16H,1-8H2 |
| InChIKey | VIAKDDMQHKSROK-UHFFFAOYSA-N |
| XLogP | -3.19 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | -3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|