C6H12KO7Sb — CID 174945582
potassium;hydride;1-O-(2-hydroxyethyl) 4-O-stibanyl 2,3-dihydroxybutanedioate (PubChem CID 174945582) has the molecular formula C6H12KO7Sb and a molecular weight of 357.01 g/mol. Its IUPAC name is potassium;hydride;1-O-(2-hydroxyethyl) 4-O-stibanyl 2,3-dihydroxybutanedioate.
| Compound Name | potassium;hydride;1-O-(2-hydroxyethyl) 4-O-stibanyl 2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 174945582 |
| Molecular Formula | C6H12KO7Sb |
| Molecular Weight | 357.01 g/mol |
| Exact Mass | 355.93 |
| IUPAC Name | potassium;hydride;1-O-(2-hydroxyethyl) 4-O-stibanyl 2,3-dihydroxybutanedioate |
| SMILES | O=C(O[SbH2])C(O)C(O)C(=O)OCCO.[H-].[K+] |
| InChI | InChI=1S/C6H10O7.K.Sb.3H/c7-1-2-13-6(12)4(9)3(8)5(10)11;;;;;/h3-4,7-9H,1-2H2,(H,10,11);;;;;/q;2*+1;;;-1/p-1 |
| InChIKey | VSJFGMIVAMUZFT-UHFFFAOYSA-M |
| XLogP | -6.55 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.01 |
| LogP ≤ 5 | -6.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|