C12H24N2O6 — CID 174588921
bis[2-(dimethylamino)ethyl] 2,3-dihydroxybutanedioate (PubChem CID 174588921) has the molecular formula C12H24N2O6 and a molecular weight of 292.33 g/mol. Its IUPAC name is bis[2-(dimethylamino)ethyl] 2,3-dihydroxybutanedioate.
| Compound Name | bis[2-(dimethylamino)ethyl] 2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 174588921 |
| Molecular Formula | C12H24N2O6 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | bis[2-(dimethylamino)ethyl] 2,3-dihydroxybutanedioate |
| SMILES | CN(C)CCOC(=O)C(O)C(O)C(=O)OCCN(C)C |
| InChI | InChI=1S/C12H24N2O6/c1-13(2)5-7-19-11(17)9(15)10(16)12(18)20-8-6-14(3)4/h9-10,15-16H,5-8H2,1-4H3 |
| InChIKey | VLSWVDQTWIWXHK-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |