About 1-O-[2-(dimethylamino)ethyl] 5-O-methyl 2-bromo-4-methylpentanedioate
1-O-[2-(dimethylamino)ethyl] 5-O-methyl 2-bromo-4-methylpentanedioate (PubChem CID 20826091) has the molecular formula C11H20BrNO4
and a molecular weight of 310.19 g/mol. Its IUPAC name is 1-O-[2-(dimethylamino)ethyl] 5-O-methyl 2-bromo-4-methylpentanedioate.
Molecular Properties
| Compound Name | 1-O-[2-(dimethylamino)ethyl] 5-O-methyl 2-bromo-4-methylpentanedioate |
| PubChem CID | 20826091 |
| Molecular Formula | C11H20BrNO4 |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 1-O-[2-(dimethylamino)ethyl] 5-O-methyl 2-bromo-4-methylpentanedioate |
| SMILES | COC(=O)C(C)CC(Br)C(=O)OCCN(C)C |
| InChI | InChI=1S/C11H20BrNO4/c1-8(10(14)16-4)7-9(12)11(15)17-6-5-13(2)3/h8-9H,5-7H2,1-4H3 |
| InChIKey | HZYCLAVKGGRCIC-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[2-(dimethylamino)ethyl] 5-O-methyl 2-bromo-4-methylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[2-(dimethylamino)ethyl] 5-O-methyl 2-bromo-4-methylpentanedioate?
The IUPAC name of 1-O-[2-(dimethylamino)ethyl] 5-O-methyl 2-bromo-4-methylpentanedioate (CID 20826091) is 1-O-[2-(dimethylamino)ethyl] 5-O-methyl 2-bromo-4-methylpentanedioate.
What is the SMILES notation for 1-O-[2-(dimethylamino)ethyl] 5-O-methyl 2-bromo-4-methylpentanedioate?
The canonical SMILES for 1-O-[2-(dimethylamino)ethyl] 5-O-methyl 2-bromo-4-methylpentanedioate is COC(=O)C(C)CC(Br)C(=O)OCCN(C)C.
What is the InChIKey of 1-O-[2-(dimethylamino)ethyl] 5-O-methyl 2-bromo-4-methylpentanedioate?
The InChIKey is HZYCLAVKGGRCIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20BrNO4/c1-8(10(14)16-4)7-9(12)11(15)17-6-5-13(2)3/h8-9H,5-7H2,1-4H3.
What are the key properties of 1-O-[2-(dimethylamino)ethyl] 5-O-methyl 2-bromo-4-methylpentanedioate?
1-O-[2-(dimethylamino)ethyl] 5-O-methyl 2-bromo-4-methylpentanedioate has a molecular weight of 310.19 g/mol, XLogP of 1.05, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[2-(dimethylamino)ethyl] 5-O-methyl 2-bromo-4-methylpentanedioate is sourced from PubChem (CID 20826091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).