About 2-(2-bromo-5-methoxy-2,4,4-trimethyl-5-oxopentanoyl)oxyethyl-(carboxymethyl)-dimethylazanium
2-(2-bromo-5-methoxy-2,4,4-trimethyl-5-oxopentanoyl)oxyethyl-(carboxymethyl)-dimethylazanium (PubChem CID 118920758) has the molecular formula C15H27BrNO6+
and a molecular weight of 397.29 g/mol. Its IUPAC name is 2-(2-bromo-5-methoxy-2,4,4-trimethyl-5-oxopentanoyl)oxyethyl-(carboxymethyl)-dimethylazanium.
Molecular Properties
| Compound Name | 2-(2-bromo-5-methoxy-2,4,4-trimethyl-5-oxopentanoyl)oxyethyl-(carboxymethyl)-dimethylazanium |
| PubChem CID | 118920758 |
| Molecular Formula | C15H27BrNO6+ |
| Molecular Weight | 397.29 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 2-(2-bromo-5-methoxy-2,4,4-trimethyl-5-oxopentanoyl)oxyethyl-(carboxymethyl)-dimethylazanium |
| SMILES | COC(=O)C(C)(C)CC(C)(Br)C(=O)OCC[N+](C)(C)CC(=O)O |
| InChI | InChI=1S/C15H26BrNO6/c1-14(2,12(20)22-6)10-15(3,16)13(21)23-8-7-17(4,5)9-11(18)19/h7-10H2,1-6H3/p+1 |
| InChIKey | MHJGULGBOOWYRF-UHFFFAOYSA-O |
| XLogP | 1.43 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-bromo-5-methoxy-2,4,4-trimethyl-5-oxopentanoyl)oxyethyl-(carboxymethyl)-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromo-5-methoxy-2,4,4-trimethyl-5-oxopentanoyl)oxyethyl-(carboxymethyl)-dimethylazanium?
The IUPAC name of 2-(2-bromo-5-methoxy-2,4,4-trimethyl-5-oxopentanoyl)oxyethyl-(carboxymethyl)-dimethylazanium (CID 118920758) is 2-(2-bromo-5-methoxy-2,4,4-trimethyl-5-oxopentanoyl)oxyethyl-(carboxymethyl)-dimethylazanium.
What is the SMILES notation for 2-(2-bromo-5-methoxy-2,4,4-trimethyl-5-oxopentanoyl)oxyethyl-(carboxymethyl)-dimethylazanium?
The canonical SMILES for 2-(2-bromo-5-methoxy-2,4,4-trimethyl-5-oxopentanoyl)oxyethyl-(carboxymethyl)-dimethylazanium is COC(=O)C(C)(C)CC(C)(Br)C(=O)OCC[N+](C)(C)CC(=O)O.
What is the InChIKey of 2-(2-bromo-5-methoxy-2,4,4-trimethyl-5-oxopentanoyl)oxyethyl-(carboxymethyl)-dimethylazanium?
The InChIKey is MHJGULGBOOWYRF-UHFFFAOYSA-O. The full InChI is InChI=1S/C15H26BrNO6/c1-14(2,12(20)22-6)10-15(3,16)13(21)23-8-7-17(4,5)9-11(18)19/h7-10H2,1-6H3/p+1.
What are the key properties of 2-(2-bromo-5-methoxy-2,4,4-trimethyl-5-oxopentanoyl)oxyethyl-(carboxymethyl)-dimethylazanium?
2-(2-bromo-5-methoxy-2,4,4-trimethyl-5-oxopentanoyl)oxyethyl-(carboxymethyl)-dimethylazanium has a molecular weight of 397.29 g/mol, XLogP of 1.43, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromo-5-methoxy-2,4,4-trimethyl-5-oxopentanoyl)oxyethyl-(carboxymethyl)-dimethylazanium is sourced from PubChem (CID 118920758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).