About 1-O-[2-(dimethylamino)ethyl] 5-O-ethyl 2-chloro-4-methylpentanedioate
1-O-[2-(dimethylamino)ethyl] 5-O-ethyl 2-chloro-4-methylpentanedioate (PubChem CID 90051387) has the molecular formula C12H22ClNO4
and a molecular weight of 279.76 g/mol. Its IUPAC name is 1-O-[2-(dimethylamino)ethyl] 5-O-ethyl 2-chloro-4-methylpentanedioate.
Molecular Properties
| Compound Name | 1-O-[2-(dimethylamino)ethyl] 5-O-ethyl 2-chloro-4-methylpentanedioate |
| PubChem CID | 90051387 |
| Molecular Formula | C12H22ClNO4 |
| Molecular Weight | 279.76 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 1-O-[2-(dimethylamino)ethyl] 5-O-ethyl 2-chloro-4-methylpentanedioate |
| SMILES | CCOC(=O)C(C)CC(Cl)C(=O)OCCN(C)C |
| InChI | InChI=1S/C12H22ClNO4/c1-5-17-11(15)9(2)8-10(13)12(16)18-7-6-14(3)4/h9-10H,5-8H2,1-4H3 |
| InChIKey | KCGKXZQGNALQKU-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.76 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[2-(dimethylamino)ethyl] 5-O-ethyl 2-chloro-4-methylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[2-(dimethylamino)ethyl] 5-O-ethyl 2-chloro-4-methylpentanedioate?
The IUPAC name of 1-O-[2-(dimethylamino)ethyl] 5-O-ethyl 2-chloro-4-methylpentanedioate (CID 90051387) is 1-O-[2-(dimethylamino)ethyl] 5-O-ethyl 2-chloro-4-methylpentanedioate.
What is the SMILES notation for 1-O-[2-(dimethylamino)ethyl] 5-O-ethyl 2-chloro-4-methylpentanedioate?
The canonical SMILES for 1-O-[2-(dimethylamino)ethyl] 5-O-ethyl 2-chloro-4-methylpentanedioate is CCOC(=O)C(C)CC(Cl)C(=O)OCCN(C)C.
What is the InChIKey of 1-O-[2-(dimethylamino)ethyl] 5-O-ethyl 2-chloro-4-methylpentanedioate?
The InChIKey is KCGKXZQGNALQKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22ClNO4/c1-5-17-11(15)9(2)8-10(13)12(16)18-7-6-14(3)4/h9-10H,5-8H2,1-4H3.
What are the key properties of 1-O-[2-(dimethylamino)ethyl] 5-O-ethyl 2-chloro-4-methylpentanedioate?
1-O-[2-(dimethylamino)ethyl] 5-O-ethyl 2-chloro-4-methylpentanedioate has a molecular weight of 279.76 g/mol, XLogP of 1.29, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[2-(dimethylamino)ethyl] 5-O-ethyl 2-chloro-4-methylpentanedioate is sourced from PubChem (CID 90051387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).