About 2-(dimethylamino)ethyl 2-amino-2-oxoacetate
2-(dimethylamino)ethyl 2-amino-2-oxoacetate (PubChem CID 89128247) has the molecular formula C6H12N2O3
and a molecular weight of 160.17 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-amino-2-oxoacetate.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl 2-amino-2-oxoacetate |
| PubChem CID | 89128247 |
| Molecular Formula | C6H12N2O3 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-amino-2-oxoacetate |
| SMILES | CN(C)CCOC(=O)C(N)=O |
| InChI | InChI=1S/C6H12N2O3/c1-8(2)3-4-11-6(10)5(7)9/h3-4H2,1-2H3,(H2,7,9) |
| InChIKey | NWUDQZGUJNXJAA-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl 2-amino-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl 2-amino-2-oxoacetate?
The IUPAC name of 2-(dimethylamino)ethyl 2-amino-2-oxoacetate (CID 89128247) is 2-(dimethylamino)ethyl 2-amino-2-oxoacetate.
What is the SMILES notation for 2-(dimethylamino)ethyl 2-amino-2-oxoacetate?
The canonical SMILES for 2-(dimethylamino)ethyl 2-amino-2-oxoacetate is CN(C)CCOC(=O)C(N)=O.
What is the InChIKey of 2-(dimethylamino)ethyl 2-amino-2-oxoacetate?
The InChIKey is NWUDQZGUJNXJAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O3/c1-8(2)3-4-11-6(10)5(7)9/h3-4H2,1-2H3,(H2,7,9).
What are the key properties of 2-(dimethylamino)ethyl 2-amino-2-oxoacetate?
2-(dimethylamino)ethyl 2-amino-2-oxoacetate has a molecular weight of 160.17 g/mol, XLogP of -1.42, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl 2-amino-2-oxoacetate is sourced from PubChem (CID 89128247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).